C34H44ClN3O — CID 71652419
6-chloro-N-[8-[4-[(2R)-2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]octyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 71652419) has the molecular formula C34H44ClN3O and a molecular weight of 546.20 g/mol. Its IUPAC name is 6-chloro-N-[8-[4-[(2R)-2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]octyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 6-chloro-N-[8-[4-[(2R)-2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]octyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 71652419 |
| Molecular Formula | C34H44ClN3O |
| Molecular Weight | 546.20 g/mol |
| Exact Mass | 545.32 |
| IUPAC Name | 6-chloro-N-[8-[4-[(2R)-2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]octyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | C#CCN(C)[C@H](C)Cc1ccc(OCCCCCCCCNc2c3c(nc4cc(Cl)ccc24)CCCC3)cc1 |
| InChI | InChI=1S/C34H44ClN3O/c1-4-22-38(3)26(2)24-27-15-18-29(19-16-27)39-23-12-8-6-5-7-11-21-36-34-30-13-9-10-14-32(30)37-33-25-28(35)17-20-31(33)34/h1,15-20,25-26H,5-14,21-24H2,2-3H3,(H,36,37)/t26-/m1/s1 |
| InChIKey | NXNSSEKZKUPRMX-AREMUKBSSA-N |
| XLogP | 8.09 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.20 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|