About 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione
6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione (PubChem CID 71652717) has the molecular formula C16H10O4
and a molecular weight of 266.25 g/mol. Its IUPAC name is 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione.
Molecular Properties
| Compound Name | 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione |
| PubChem CID | 71652717 |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione |
| SMILES | Cc1ccc2c(c1)OC1(OC(=O)c3ccccc31)C2=O |
| InChI | InChI=1S/C16H10O4/c1-9-6-7-11-13(8-9)19-16(14(11)17)12-5-3-2-4-10(12)15(18)20-16/h2-8H,1H3 |
| InChIKey | HMKFDZUHYBHVTP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
The IUPAC name of 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione (CID 71652717) is 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione.
What is the SMILES notation for 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
The canonical SMILES for 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione is Cc1ccc2c(c1)OC1(OC(=O)c3ccccc31)C2=O.
What is the InChIKey of 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
The InChIKey is HMKFDZUHYBHVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O4/c1-9-6-7-11-13(8-9)19-16(14(11)17)12-5-3-2-4-10(12)15(18)20-16/h2-8H,1H3.
What are the key properties of 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione has a molecular weight of 266.25 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione is sourced from PubChem (CID 71652717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).