C19H14N4 — CID 71652871
12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,12,15-heptaene (PubChem CID 71652871) has the molecular formula C19H14N4 and a molecular weight of 298.35 g/mol. Its IUPAC name is 12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,12,15-heptaene.
| Compound Name | 12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,12,15-heptaene |
|---|---|
| PubChem CID | 71652871 |
| Molecular Formula | C19H14N4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,12,15-heptaene |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(nc12)Cc1ccccc1-3 |
| InChI | InChI=1S/C19H14N4/c1-12-17-19(23(22-12)14-8-3-2-4-9-14)21-18-15-10-6-5-7-13(15)11-16(18)20-17/h2-10H,11H2,1H3 |
| InChIKey | VHJXQYVONIWBFO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |