About 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione
4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione (PubChem CID 71653029) has the molecular formula C17H12O4
and a molecular weight of 280.28 g/mol. Its IUPAC name is 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione.
Molecular Properties
| Compound Name | 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione |
| PubChem CID | 71653029 |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione |
| SMILES | Cc1ccc(C)c2c1OC1(OC(=O)c3ccccc31)C2=O |
| InChI | InChI=1S/C17H12O4/c1-9-7-8-10(2)14-13(9)15(18)17(20-14)12-6-4-3-5-11(12)16(19)21-17/h3-8H,1-2H3 |
| InChIKey | KKMAPEHSILYSNX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
The IUPAC name of 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione (CID 71653029) is 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione.
What is the SMILES notation for 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
The canonical SMILES for 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione is Cc1ccc(C)c2c1OC1(OC(=O)c3ccccc31)C2=O.
What is the InChIKey of 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
The InChIKey is KKMAPEHSILYSNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O4/c1-9-7-8-10(2)14-13(9)15(18)17(20-14)12-6-4-3-5-11(12)16(19)21-17/h3-8H,1-2H3.
What are the key properties of 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione?
4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione has a molecular weight of 280.28 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethylspiro[1-benzofuran-2,3'-2-benzofuran]-1',3-dione is sourced from PubChem (CID 71653029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).