C19H31N3 — CID 71653097
(1R,4S,6R,10S)-6,10-bis(2-cyclopropylethyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71653097) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is (1R,4S,6R,10S)-6,10-bis(2-cyclopropylethyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-6,10-bis(2-cyclopropylethyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71653097 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (1R,4S,6R,10S)-6,10-bis(2-cyclopropylethyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | C1CC1CC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](CCC4CC4)NC(=N1)N32 |
| InChI | InChI=1S/C19H31N3/c1-2-13(1)5-7-15-11-17-9-10-18-12-16(8-6-14-3-4-14)21-19(20-15)22(17)18/h13-18H,1-12H2,(H,20,21)/t15-,16+,17+,18- |
| InChIKey | BHSQIQWEGQVIJV-FZDBZEDMSA-N |
| XLogP | 3.69 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |