C26H25NO — CID 71653252
5,6,7,8-tetrahydronaphthalen-2-yl-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-pyridinyl]methanone (PubChem CID 71653252) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-2-yl-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-pyridinyl]methanone.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-2-yl-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 71653252 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-2-yl-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc3c(c2)CCCC3)nc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C26H25NO/c28-26(23-12-10-19-6-2-4-8-21(19)16-23)24-13-14-25(27-17-24)22-11-9-18-5-1-3-7-20(18)15-22/h9-17H,1-8H2 |
| InChIKey | OULQDPFJFXDZNR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |