C16H29N3 — CID 71653394
(1R,4S,6R,10S)-10-methyl-6-(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71653394) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is (1R,4S,6R,10S)-10-methyl-6-(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-10-methyl-6-(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71653394 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | (1R,4S,6R,10S)-10-methyl-6-(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | CC(C)CCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](C)NC(=N1)N32 |
| InChI | InChI=1S/C16H29N3/c1-11(2)5-4-6-13-10-15-8-7-14-9-12(3)17-16(18-13)19(14)15/h11-15H,4-10H2,1-3H3,(H,17,18)/t12-,13+,14+,15-/m0/s1 |
| InChIKey | DDUMSPRNSFRPSJ-YJNKXOJESA-N |
| XLogP | 3.16 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |