C15H20F3NO3S — CID 71653448
[2-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate (PubChem CID 71653448) has the molecular formula C15H20F3NO3S and a molecular weight of 351.39 g/mol. Its IUPAC name is [2-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71653448 |
| Molecular Formula | C15H20F3NO3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [2-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CCCN1CCC(c2ccccc2OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F3NO3S/c1-2-9-19-10-7-12(8-11-19)13-5-3-4-6-14(13)22-23(20,21)15(16,17)18/h3-6,12H,2,7-11H2,1H3 |
| InChIKey | VLKDFZOMFXZXEJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|