C14H21N3 — CID 71653535
(1R,4S,6R,10S)-6-but-3-ynyl-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71653535) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (1R,4S,6R,10S)-6-but-3-ynyl-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-6-but-3-ynyl-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71653535 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (1R,4S,6R,10S)-6-but-3-ynyl-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | C#CCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](C)NC(=N1)N32 |
| InChI | InChI=1S/C14H21N3/c1-3-4-5-11-9-13-7-6-12-8-10(2)15-14(16-11)17(12)13/h1,10-13H,4-9H2,2H3,(H,15,16)/t10-,11+,12+,13-/m0/s1 |
| InChIKey | MRCCRTQAIVSLAS-LOWDOPEQSA-N |
| XLogP | 1.74 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|