C15H25N3 — CID 71653671
(1R,4S,6R,10S)-6-(2-cyclopropylethyl)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71653671) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (1R,4S,6R,10S)-6-(2-cyclopropylethyl)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-6-(2-cyclopropylethyl)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71653671 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (1R,4S,6R,10S)-6-(2-cyclopropylethyl)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | C[C@H]1C[C@H]2CC[C@H]3C[C@@H](CCC4CC4)N=C(N1)N23 |
| InChI | InChI=1S/C15H25N3/c1-10-8-13-6-7-14-9-12(5-4-11-2-3-11)17-15(16-10)18(13)14/h10-14H,2-9H2,1H3,(H,16,17)/t10-,12+,13+,14-/m0/s1 |
| InChIKey | YUVXSNGKSHFHKX-ASEORRQLSA-N |
| XLogP | 2.52 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |