C17H31N3 — CID 71653673
(3S,5R,9S,11R)-11-methyl-3-(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71653673) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is (3S,5R,9S,11R)-11-methyl-3-(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | (3S,5R,9S,11R)-11-methyl-3-(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71653673 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | (3S,5R,9S,11R)-11-methyl-3-(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | CC(C)CCC[C@H]1C[C@H]2CCC[C@H]3C[C@@H](C)NC(=N1)N23 |
| InChI | InChI=1S/C17H31N3/c1-12(2)6-4-7-14-11-16-9-5-8-15-10-13(3)18-17(19-14)20(15)16/h12-16H,4-11H2,1-3H3,(H,18,19)/t13-,14+,15+,16-/m1/s1 |
| InChIKey | RHSVQMFZWASERP-FXUDXRNXSA-N |
| XLogP | 3.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |