C15H25N3 — CID 71653676
(3S,5R,9S,11R)-3-but-3-enyl-11-methyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71653676) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (3S,5R,9S,11R)-3-but-3-enyl-11-methyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | (3S,5R,9S,11R)-3-but-3-enyl-11-methyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71653676 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (3S,5R,9S,11R)-3-but-3-enyl-11-methyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | C=CCC[C@H]1C[C@H]2CCC[C@H]3C[C@@H](C)NC(=N1)N23 |
| InChI | InChI=1S/C15H25N3/c1-3-4-6-12-10-14-8-5-7-13-9-11(2)16-15(17-12)18(13)14/h3,11-14H,1,4-10H2,2H3,(H,16,17)/t11-,12+,13+,14-/m1/s1 |
| InChIKey | DBLFUEKXZOQDDF-ZOBORPQBSA-N |
| XLogP | 2.69 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|