C20H23NO5 — CID 71653707
8-methoxy-5-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1-benzoxepin-9-amine (PubChem CID 71653707) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 8-methoxy-5-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1-benzoxepin-9-amine.
| Compound Name | 8-methoxy-5-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1-benzoxepin-9-amine |
|---|---|
| PubChem CID | 71653707 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 8-methoxy-5-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1-benzoxepin-9-amine |
| SMILES | COc1ccc2c(c1N)OCCC=C2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H23NO5/c1-22-15-8-7-14-13(6-5-9-26-19(14)18(15)21)12-10-16(23-2)20(25-4)17(11-12)24-3/h6-8,10-11H,5,9,21H2,1-4H3 |
| InChIKey | PJOMMCGJYUBGTB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|