C18H32O7 — CID 71653724
(2S,3R,4S,5R,6R)-6-(4-octoxybut-2-ynoxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 71653724) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(4-octoxybut-2-ynoxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R,6R)-6-(4-octoxybut-2-ynoxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 71653724 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(4-octoxybut-2-ynoxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CCCCCCCCOCC#CCOC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H32O7/c1-2-3-4-5-6-7-10-23-11-8-9-12-24-13-14-15(19)16(20)17(21)18(22)25-14/h14-22H,2-7,10-13H2,1H3/t14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | ZVRLQNBKIBNORM-ICUGJSFKSA-N |
| XLogP | 0.18 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|