C15H10N8O4 — CID 71653846
5-(2,4-dinitrophenyl)-2-imino-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine (PubChem CID 71653846) has the molecular formula C15H10N8O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is 5-(2,4-dinitrophenyl)-2-imino-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine.
| Compound Name | 5-(2,4-dinitrophenyl)-2-imino-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine |
|---|---|
| PubChem CID | 71653846 |
| Molecular Formula | C15H10N8O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 5-(2,4-dinitrophenyl)-2-imino-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine |
| SMILES | [H]/N=c1/c2c(N)n(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])nc2nc2ccccn12 |
| InChI | InChI=1S/C15H10N8O4/c16-13-12-14(17)21(19-15(12)18-11-3-1-2-6-20(11)13)9-5-4-8(22(24)25)7-10(9)23(26)27/h1-7,16H,17H2/b16-13- |
| InChIKey | PHUKDRNCPWCLAY-SSZFMOIBSA-N |
| XLogP | 1.55 |
| TPSA | 171.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|