C17H13N7S — CID 71653848
2-imino-5-(6-methyl-1,3-benzothiazol-2-yl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine (PubChem CID 71653848) has the molecular formula C17H13N7S and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-imino-5-(6-methyl-1,3-benzothiazol-2-yl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine.
| Compound Name | 2-imino-5-(6-methyl-1,3-benzothiazol-2-yl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine |
|---|---|
| PubChem CID | 71653848 |
| Molecular Formula | C17H13N7S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-imino-5-(6-methyl-1,3-benzothiazol-2-yl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3,6,8,10,12-pentaen-4-amine |
| SMILES | [H]/N=c1/c2c(N)n(-c3nc4ccc(C)cc4s3)nc2nc2ccccn12 |
| InChI | InChI=1S/C17H13N7S/c1-9-5-6-10-11(8-9)25-17(20-10)24-15(19)13-14(18)23-7-3-2-4-12(23)21-16(13)22-24/h2-8,18H,19H2,1H3/b18-14- |
| InChIKey | VXWSTXNOJZYXOU-JXAWBTAJSA-N |
| XLogP | 2.65 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |