C7H12ClF2NaO2S — CID 71653950
sodium 7-chloro-1,1-difluoroheptane-1-sulfinate (PubChem CID 71653950) has the molecular formula C7H12ClF2NaO2S and a molecular weight of 256.68 g/mol. Its IUPAC name is sodium 7-chloro-1,1-difluoroheptane-1-sulfinate.
| Compound Name | sodium 7-chloro-1,1-difluoroheptane-1-sulfinate |
|---|---|
| PubChem CID | 71653950 |
| Molecular Formula | C7H12ClF2NaO2S |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | sodium 7-chloro-1,1-difluoroheptane-1-sulfinate |
| SMILES | O=S([O-])C(F)(F)CCCCCCCl.[Na+] |
| InChI | InChI=1S/C7H13ClF2O2S.Na/c8-6-4-2-1-3-5-7(9,10)13(11)12;/h1-6H2,(H,11,12);/q;+1/p-1 |
| InChIKey | LFIQXRUQAPPIPD-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|