About 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole
5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole (PubChem CID 71654524) has the molecular formula C18H15ClN4S
and a molecular weight of 354.87 g/mol. Its IUPAC name is 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole |
| PubChem CID | 71654524 |
| Molecular Formula | C18H15ClN4S |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole |
| SMILES | Cc1nc(-c2cccnc2)sc1C1=NNC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H15ClN4S/c1-11-17(24-18(21-11)13-3-2-8-20-10-13)16-9-15(22-23-16)12-4-6-14(19)7-5-12/h2-8,10,15,22H,9H2,1H3 |
| InChIKey | SQCYNSYVIKWNGE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole?
The IUPAC name of 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole (CID 71654524) is 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole.
What is the SMILES notation for 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole?
The canonical SMILES for 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole is Cc1nc(-c2cccnc2)sc1C1=NNC(c2ccc(Cl)cc2)C1.
What is the InChIKey of 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole?
The InChIKey is SQCYNSYVIKWNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN4S/c1-11-17(24-18(21-11)13-3-2-8-20-10-13)16-9-15(22-23-16)12-4-6-14(19)7-5-12/h2-8,10,15,22H,9H2,1H3.
What are the key properties of 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole?
5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole has a molecular weight of 354.87 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methyl-2-pyridin-3-yl-1,3-thiazole is sourced from PubChem (CID 71654524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).