About 2-ethylsulfinylnaphthalene-1,4-dione
2-ethylsulfinylnaphthalene-1,4-dione (PubChem CID 71654557) has the molecular formula C12H10O3S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-ethylsulfinylnaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-ethylsulfinylnaphthalene-1,4-dione |
| PubChem CID | 71654557 |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 2-ethylsulfinylnaphthalene-1,4-dione |
| SMILES | CCS(=O)C1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H10O3S/c1-2-16(15)11-7-10(13)8-5-3-4-6-9(8)12(11)14/h3-7H,2H2,1H3 |
| InChIKey | AGBFHKNHQNSNAF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfinylnaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfinylnaphthalene-1,4-dione?
The IUPAC name of 2-ethylsulfinylnaphthalene-1,4-dione (CID 71654557) is 2-ethylsulfinylnaphthalene-1,4-dione.
What is the SMILES notation for 2-ethylsulfinylnaphthalene-1,4-dione?
The canonical SMILES for 2-ethylsulfinylnaphthalene-1,4-dione is CCS(=O)C1=CC(=O)c2ccccc2C1=O.
What is the InChIKey of 2-ethylsulfinylnaphthalene-1,4-dione?
The InChIKey is AGBFHKNHQNSNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O3S/c1-2-16(15)11-7-10(13)8-5-3-4-6-9(8)12(11)14/h3-7H,2H2,1H3.
What are the key properties of 2-ethylsulfinylnaphthalene-1,4-dione?
2-ethylsulfinylnaphthalene-1,4-dione has a molecular weight of 234.28 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfinylnaphthalene-1,4-dione is sourced from PubChem (CID 71654557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).