About trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane
trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane (PubChem CID 71654607) has the molecular formula C13H20SSn
and a molecular weight of 327.08 g/mol. Its IUPAC name is trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane.
Molecular Properties
| Compound Name | trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane |
| PubChem CID | 71654607 |
| Molecular Formula | C13H20SSn |
| Molecular Weight | 327.08 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane |
| SMILES | C[Sn](C)(C)c1scc2c1C1CCC2CC1 |
| InChI | InChI=1S/C10H11S.3CH3.Sn/c1-2-8-4-3-7(1)9-5-11-6-10(8)9;;;;/h5,7-8H,1-4H2;3*1H3; |
| InChIKey | VEDWABZJYWGSGH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.08 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane?
The IUPAC name of trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane (CID 71654607) is trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane.
What is the SMILES notation for trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane?
The canonical SMILES for trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane is C[Sn](C)(C)c1scc2c1C1CCC2CC1.
What is the InChIKey of trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane?
The InChIKey is VEDWABZJYWGSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11S.3CH3.Sn/c1-2-8-4-3-7(1)9-5-11-6-10(8)9;;;;/h5,7-8H,1-4H2;3*1H3;.
What are the key properties of trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane?
trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane has a molecular weight of 327.08 g/mol, XLogP of 4.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(4-thiatricyclo[5.2.2.02,6]undeca-2,5-dien-3-yl)stannane is sourced from PubChem (CID 71654607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).