C23H27NO4 — CID 71654615
(2R)-2-[[[(1R)-1-(9H-fluoren-9-yl)ethoxy]carbonylamino]methyl]-4-methylpentanoic acid (PubChem CID 71654615) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (2R)-2-[[[(1R)-1-(9H-fluoren-9-yl)ethoxy]carbonylamino]methyl]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[[(1R)-1-(9H-fluoren-9-yl)ethoxy]carbonylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 71654615 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2R)-2-[[[(1R)-1-(9H-fluoren-9-yl)ethoxy]carbonylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](CNC(=O)O[C@H](C)C1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C23H27NO4/c1-14(2)12-16(22(25)26)13-24-23(27)28-15(3)21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,14-16,21H,12-13H2,1-3H3,(H,24,27)(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | BLTRYQAPSNFBLB-HZPDHXFCSA-N |
| XLogP | 4.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |