About 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea
1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea (PubChem CID 71654679) has the molecular formula C20H24N4OS
and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea |
| PubChem CID | 71654679 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea |
| SMILES | CCc1ccccc1-c1ccc2nc(NC(=O)NCCN(C)C)sc2c1 |
| InChI | InChI=1S/C20H24N4OS/c1-4-14-7-5-6-8-16(14)15-9-10-17-18(13-15)26-20(22-17)23-19(25)21-11-12-24(2)3/h5-10,13H,4,11-12H2,1-3H3,(H2,21,22,23,25) |
| InChIKey | HZTRFYKKMCHMIG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea?
The IUPAC name of 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea (CID 71654679) is 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea.
What is the SMILES notation for 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea?
The canonical SMILES for 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea is CCc1ccccc1-c1ccc2nc(NC(=O)NCCN(C)C)sc2c1.
What is the InChIKey of 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea?
The InChIKey is HZTRFYKKMCHMIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4OS/c1-4-14-7-5-6-8-16(14)15-9-10-17-18(13-15)26-20(22-17)23-19(25)21-11-12-24(2)3/h5-10,13H,4,11-12H2,1-3H3,(H2,21,22,23,25).
What are the key properties of 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea?
1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea has a molecular weight of 368.51 g/mol, XLogP of 4.21, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethyl]-3-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]urea is sourced from PubChem (CID 71654679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).