C22H34O5 — CID 71654752
(1S,2S,4S,5R,9S,10S,13S,14R)-14-acetyloxy-2-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 71654752) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (1S,2S,4S,5R,9S,10S,13S,14R)-14-acetyloxy-2-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | (1S,2S,4S,5R,9S,10S,13S,14R)-14-acetyloxy-2-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 71654752 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1S,2S,4S,5R,9S,10S,13S,14R)-14-acetyloxy-2-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | CC(=O)O[C@@H]1C[C@@]23C[C@]1(C)CC[C@H]2[C@]1(C)CCC[C@@](C)(C(=O)O)[C@H]1C[C@@H]3O |
| InChI | InChI=1S/C22H34O5/c1-13(23)27-17-11-22-12-19(17,2)9-6-14(22)20(3)7-5-8-21(4,18(25)26)15(20)10-16(22)24/h14-17,24H,5-12H2,1-4H3,(H,25,26)/t14-,15-,16-,17+,19-,20-,21+,22+/m0/s1 |
| InChIKey | MSLCEMYYLUMFEP-ILFRUASBSA-N |
| XLogP | 3.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |