About 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide
4-chlorothieno[3,2-d]pyrimidine-6-carboxamide (PubChem CID 71654770) has the molecular formula C7H4ClN3OS
and a molecular weight of 213.65 g/mol. Its IUPAC name is 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide |
| PubChem CID | 71654770 |
| Molecular Formula | C7H4ClN3OS |
| Molecular Weight | 213.65 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide |
| SMILES | NC(=O)c1cc2ncnc(Cl)c2s1 |
| InChI | InChI=1S/C7H4ClN3OS/c8-6-5-3(10-2-11-6)1-4(13-5)7(9)12/h1-2H,(H2,9,12) |
| InChIKey | UGHXFHLQVJRWID-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.65 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide?
The IUPAC name of 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide (CID 71654770) is 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide.
What is the SMILES notation for 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide?
The canonical SMILES for 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide is NC(=O)c1cc2ncnc(Cl)c2s1.
What is the InChIKey of 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide?
The InChIKey is UGHXFHLQVJRWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3OS/c8-6-5-3(10-2-11-6)1-4(13-5)7(9)12/h1-2H,(H2,9,12).
What are the key properties of 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide?
4-chlorothieno[3,2-d]pyrimidine-6-carboxamide has a molecular weight of 213.65 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorothieno[3,2-d]pyrimidine-6-carboxamide is sourced from PubChem (CID 71654770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).