About 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide
4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide (PubChem CID 71654775) has the molecular formula C12H14N4OS
and a molecular weight of 262.34 g/mol. Its IUPAC name is 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide |
| PubChem CID | 71654775 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide |
| SMILES | NC(=O)c1cc2ncnc(N3CCCCC3)c2s1 |
| InChI | InChI=1S/C12H14N4OS/c13-11(17)9-6-8-10(18-9)12(15-7-14-8)16-4-2-1-3-5-16/h6-7H,1-5H2,(H2,13,17) |
| InChIKey | OGGAXCGKZTXIMR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide?
The IUPAC name of 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide (CID 71654775) is 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide.
What is the SMILES notation for 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide?
The canonical SMILES for 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide is NC(=O)c1cc2ncnc(N3CCCCC3)c2s1.
What is the InChIKey of 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide?
The InChIKey is OGGAXCGKZTXIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS/c13-11(17)9-6-8-10(18-9)12(15-7-14-8)16-4-2-1-3-5-16/h6-7H,1-5H2,(H2,13,17).
What are the key properties of 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide?
4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide has a molecular weight of 262.34 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-1-ylthieno[3,2-d]pyrimidine-6-carboxamide is sourced from PubChem (CID 71654775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).