C26H25F2N3O4 — CID 71654786
methyl (E)-2-[2-[[2-(2,4-difluoroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 71654786) has the molecular formula C26H25F2N3O4 and a molecular weight of 481.50 g/mol. Its IUPAC name is methyl (E)-2-[2-[[2-(2,4-difluoroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[2-(2,4-difluoroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 71654786 |
| Molecular Formula | C26H25F2N3O4 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl (E)-2-[2-[[2-(2,4-difluoroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1nc(Nc2ccc(F)cc2F)nc2c1CCCC2 |
| InChI | InChI=1S/C26H25F2N3O4/c1-33-15-20(25(32)34-2)18-8-4-3-7-16(18)14-35-24-19-9-5-6-10-22(19)29-26(31-24)30-23-12-11-17(27)13-21(23)28/h3-4,7-8,11-13,15H,5-6,9-10,14H2,1-2H3,(H,29,30,31)/b20-15+ |
| InChIKey | XZIIPGWWLPRDGS-HMMYKYKNSA-N |
| XLogP | 5.12 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|