C25H25F3N6O2 — CID 71654881
4-(4-methylpiperazin-1-yl)-N-[5-[2-(2,3,5-trifluorophenyl)acetyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide (PubChem CID 71654881) has the molecular formula C25H25F3N6O2 and a molecular weight of 498.51 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-N-[5-[2-(2,3,5-trifluorophenyl)acetyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-N-[5-[2-(2,3,5-trifluorophenyl)acetyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 71654881 |
| Molecular Formula | C25H25F3N6O2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-N-[5-[2-(2,3,5-trifluorophenyl)acetyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3n[nH]c4c3CN(C(=O)Cc3cc(F)cc(F)c3F)C4)cc2)CC1 |
| InChI | InChI=1S/C25H25F3N6O2/c1-32-6-8-33(9-7-32)18-4-2-15(3-5-18)25(36)29-24-19-13-34(14-21(19)30-31-24)22(35)11-16-10-17(26)12-20(27)23(16)28/h2-5,10,12H,6-9,11,13-14H2,1H3,(H2,29,30,31,36) |
| InChIKey | YQXYADWUGFYAGE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|