About 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide
5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 71654884) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide.
Molecular Properties
| Compound Name | 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
| PubChem CID | 71654884 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CCCCCCNC(=O)n1cc(CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N3O3/c1-3-5-6-7-8-14-12(18)16-9-10(4-2)11(17)15-13(16)19/h9H,3-8H2,1-2H3,(H,14,18)(H,15,17,19) |
| InChIKey | KTQZLYPNFBVPDF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
The IUPAC name of 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide (CID 71654884) is 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide.
What is the SMILES notation for 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
The canonical SMILES for 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide is CCCCCCNC(=O)n1cc(CC)c(=O)[nH]c1=O.
What is the InChIKey of 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
The InChIKey is KTQZLYPNFBVPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-3-5-6-7-8-14-12(18)16-9-10(4-2)11(17)15-13(16)19/h9H,3-8H2,1-2H3,(H,14,18)(H,15,17,19).
What are the key properties of 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide has a molecular weight of 267.33 g/mol, XLogP of 1.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N-hexyl-2,4-dioxopyrimidine-1-carboxamide is sourced from PubChem (CID 71654884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).