C13H18O5S2 — CID 71654934
(2S,3R,4S,5R,6R)-2-(benzyldisulfanyl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71654934) has the molecular formula C13H18O5S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(benzyldisulfanyl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-(benzyldisulfanyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71654934 |
| Molecular Formula | C13H18O5S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(benzyldisulfanyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](SSCc2ccccc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18O5S2/c14-6-9-10(15)11(16)12(17)13(18-9)20-19-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10+,11+,12-,13+/m1/s1 |
| InChIKey | QBQGHUWKYXMVED-SJHCENCUSA-N |
| XLogP | 0.37 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|