C10H14O5 — CID 71655105
(3aS,6S,7R,7aS)-6,7-dihydroxy-6-methylspiro[4,5,7,7a-tetrahydro-3aH-1-benzofuran-3,2'-oxirane]-2-one (PubChem CID 71655105) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (3aS,6S,7R,7aS)-6,7-dihydroxy-6-methylspiro[4,5,7,7a-tetrahydro-3aH-1-benzofuran-3,2'-oxirane]-2-one.
| Compound Name | (3aS,6S,7R,7aS)-6,7-dihydroxy-6-methylspiro[4,5,7,7a-tetrahydro-3aH-1-benzofuran-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 71655105 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (3aS,6S,7R,7aS)-6,7-dihydroxy-6-methylspiro[4,5,7,7a-tetrahydro-3aH-1-benzofuran-3,2'-oxirane]-2-one |
| SMILES | C[C@]1(O)CC[C@H]2[C@H](OC(=O)C23CO3)[C@H]1O |
| InChI | InChI=1S/C10H14O5/c1-9(13)3-2-5-6(7(9)11)15-8(12)10(5)4-14-10/h5-7,11,13H,2-4H2,1H3/t5-,6-,7+,9-,10?/m0/s1 |
| InChIKey | XBSLSVHALDMLEQ-DJGCSZQWSA-N |
| XLogP | -0.80 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|