C25H30N2O2 — CID 71655545
N-[(4aS,5R,10bS)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]benzamide (PubChem CID 71655545) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[(4aS,5R,10bS)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]benzamide.
| Compound Name | N-[(4aS,5R,10bS)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]benzamide |
|---|---|
| PubChem CID | 71655545 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[(4aS,5R,10bS)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](C1CCCCC1)N2)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O2/c28-25(18-10-5-2-6-11-18)26-19-13-14-22-21(16-19)24-20(12-7-15-29-24)23(27-22)17-8-3-1-4-9-17/h2,5-6,10-11,13-14,16-17,20,23-24,27H,1,3-4,7-9,12,15H2,(H,26,28)/t20-,23+,24-/m0/s1 |
| InChIKey | XTLJTMJVTYEXLV-ZTCOLXNVSA-N |
| XLogP | 5.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |