About 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea
1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea (PubChem CID 71655597) has the molecular formula C17H17N3O2S
and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea |
| PubChem CID | 71655597 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2ccc(-c3ccccc3OC)cc2s1 |
| InChI | InChI=1S/C17H17N3O2S/c1-3-18-16(21)20-17-19-13-9-8-11(10-15(13)23-17)12-6-4-5-7-14(12)22-2/h4-10H,3H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | LGPZTQXZPZVKSU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea?
The IUPAC name of 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea (CID 71655597) is 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea.
What is the SMILES notation for 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea?
The canonical SMILES for 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea is CCNC(=O)Nc1nc2ccc(-c3ccccc3OC)cc2s1.
What is the InChIKey of 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea?
The InChIKey is LGPZTQXZPZVKSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2S/c1-3-18-16(21)20-17-19-13-9-8-11(10-15(13)23-17)12-6-4-5-7-14(12)22-2/h4-10H,3H2,1-2H3,(H2,18,19,20,21).
What are the key properties of 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea?
1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea has a molecular weight of 327.41 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea is sourced from PubChem (CID 71655597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).