About 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea
1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea (PubChem CID 71655598) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea |
| PubChem CID | 71655598 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2ccc(-c3ccccc3OCC)cc2s1 |
| InChI | InChI=1S/C18H19N3O2S/c1-3-19-17(22)21-18-20-14-10-9-12(11-16(14)24-18)13-7-5-6-8-15(13)23-4-2/h5-11H,3-4H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | WIVSFJKYGWJWQH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea?
The IUPAC name of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea (CID 71655598) is 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea.
What is the SMILES notation for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea?
The canonical SMILES for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea is CCNC(=O)Nc1nc2ccc(-c3ccccc3OCC)cc2s1.
What is the InChIKey of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea?
The InChIKey is WIVSFJKYGWJWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-3-19-17(22)21-18-20-14-10-9-12(11-16(14)24-18)13-7-5-6-8-15(13)23-4-2/h5-11H,3-4H2,1-2H3,(H2,19,20,21,22).
What are the key properties of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea?
1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea has a molecular weight of 341.44 g/mol, XLogP of 4.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-ethylurea is sourced from PubChem (CID 71655598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).