C22H33NO — CID 71655612
(3aS,4R,9bS)-4-cyclohexyl-8-pentyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 71655612) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (3aS,4R,9bS)-4-cyclohexyl-8-pentyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,4R,9bS)-4-cyclohexyl-8-pentyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 71655612 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (3aS,4R,9bS)-4-cyclohexyl-8-pentyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | CCCCCc1ccc2c(c1)[C@H]1OCC[C@H]1[C@@H](C1CCCCC1)N2 |
| InChI | InChI=1S/C22H33NO/c1-2-3-5-8-16-11-12-20-19(15-16)22-18(13-14-24-22)21(23-20)17-9-6-4-7-10-17/h11-12,15,17-18,21-23H,2-10,13-14H2,1H3/t18-,21+,22-/m0/s1 |
| InChIKey | PLOUXGVSNIUAMA-BWAGFHJFSA-N |
| XLogP | 5.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|