C19H27NO2 — CID 71655685
(4aS,5R,10bS)-9-butoxy-5-cyclopropyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 71655685) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (4aS,5R,10bS)-9-butoxy-5-cyclopropyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-9-butoxy-5-cyclopropyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 71655685 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (4aS,5R,10bS)-9-butoxy-5-cyclopropyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCCCOc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](C1CC1)N2 |
| InChI | InChI=1S/C19H27NO2/c1-2-3-10-21-14-8-9-17-16(12-14)19-15(5-4-11-22-19)18(20-17)13-6-7-13/h8-9,12-13,15,18-20H,2-7,10-11H2,1H3/t15-,18+,19-/m0/s1 |
| InChIKey | GBQVMEOAUDISBW-IPELMVKDSA-N |
| XLogP | 4.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|