C20H18N4O3 — CID 7165569
4-[(5R)-1,3-dimethyl-2,4,6-trioxo-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinolin-5-yl]benzonitrile (PubChem CID 7165569) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[(5R)-1,3-dimethyl-2,4,6-trioxo-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinolin-5-yl]benzonitrile.
| Compound Name | 4-[(5R)-1,3-dimethyl-2,4,6-trioxo-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinolin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 7165569 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-[(5R)-1,3-dimethyl-2,4,6-trioxo-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinolin-5-yl]benzonitrile |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@H](c1ccc(C#N)cc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C20H18N4O3/c1-23-18-17(19(26)24(2)20(23)27)15(12-8-6-11(10-21)7-9-12)16-13(22-18)4-3-5-14(16)25/h6-9,15,22H,3-5H2,1-2H3/t15-/m1/s1 |
| InChIKey | VNWMQJMNPPVEAT-OAHLLOKOSA-N |
| XLogP | 1.52 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |