About 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea
1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea (PubChem CID 71655733) has the molecular formula C19H21N3O3S
and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea.
Molecular Properties
| Compound Name | 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea |
| PubChem CID | 71655733 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea |
| SMILES | CCOc1ccccc1-c1ccc2nc(NC(=O)NCCCO)sc2c1 |
| InChI | InChI=1S/C19H21N3O3S/c1-2-25-16-7-4-3-6-14(16)13-8-9-15-17(12-13)26-19(21-15)22-18(24)20-10-5-11-23/h3-4,6-9,12,23H,2,5,10-11H2,1H3,(H2,20,21,22,24) |
| InChIKey | FSILAVJWZRLDRJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea?
The IUPAC name of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea (CID 71655733) is 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea.
What is the SMILES notation for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea?
The canonical SMILES for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea is CCOc1ccccc1-c1ccc2nc(NC(=O)NCCCO)sc2c1.
What is the InChIKey of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea?
The InChIKey is FSILAVJWZRLDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3S/c1-2-25-16-7-4-3-6-14(16)13-8-9-15-17(12-13)26-19(21-15)22-18(24)20-10-5-11-23/h3-4,6-9,12,23H,2,5,10-11H2,1H3,(H2,20,21,22,24).
What are the key properties of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea?
1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea has a molecular weight of 371.46 g/mol, XLogP of 3.87, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(3-hydroxypropyl)urea is sourced from PubChem (CID 71655733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).