About 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea
1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 71655734) has the molecular formula C22H27N5O2S
and a molecular weight of 425.56 g/mol. Its IUPAC name is 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea.
Molecular Properties
| Compound Name | 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea |
| PubChem CID | 71655734 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | CCOc1ccccc1-c1ccc2nc(NC(=O)NCCN3CCNCC3)sc2c1 |
| InChI | InChI=1S/C22H27N5O2S/c1-2-29-19-6-4-3-5-17(19)16-7-8-18-20(15-16)30-22(25-18)26-21(28)24-11-14-27-12-9-23-10-13-27/h3-8,15,23H,2,9-14H2,1H3,(H2,24,25,26,28) |
| InChIKey | DZDUTNLSSQXEMT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea?
The IUPAC name of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea (CID 71655734) is 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea.
What is the SMILES notation for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea?
The canonical SMILES for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea is CCOc1ccccc1-c1ccc2nc(NC(=O)NCCN3CCNCC3)sc2c1.
What is the InChIKey of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea?
The InChIKey is DZDUTNLSSQXEMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5O2S/c1-2-29-19-6-4-3-5-17(19)16-7-8-18-20(15-16)30-22(25-18)26-21(28)24-11-14-27-12-9-23-10-13-27/h3-8,15,23H,2,9-14H2,1H3,(H2,24,25,26,28).
What are the key properties of 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea?
1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea has a molecular weight of 425.56 g/mol, XLogP of 3.39, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2-ethoxyphenyl)-1,3-benzothiazol-2-yl]-3-(2-piperazin-1-ylethyl)urea is sourced from PubChem (CID 71655734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).