C22H27NO2 — CID 71655744
(4aS,5S,10bS)-9-butoxy-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 71655744) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (4aS,5S,10bS)-9-butoxy-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5S,10bS)-9-butoxy-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 71655744 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (4aS,5S,10bS)-9-butoxy-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCCCOc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C22H27NO2/c1-2-3-13-24-17-11-12-20-19(15-17)22-18(10-7-14-25-22)21(23-20)16-8-5-4-6-9-16/h4-6,8-9,11-12,15,18,21-23H,2-3,7,10,13-14H2,1H3/t18-,21+,22-/m0/s1 |
| InChIKey | JJWRAXHRNFPMHT-BWAGFHJFSA-N |
| XLogP | 5.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|