About trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride
trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride (PubChem CID 71656092) has the molecular formula C4H7ClF3N
and a molecular weight of 161.55 g/mol. Its IUPAC name is trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride |
| PubChem CID | 71656092 |
| Molecular Formula | C4H7ClF3N |
| Molecular Weight | 161.55 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C4H6F3N.ClH/c5-4(6,7)2-1-3(2)8;/h2-3H,1,8H2;1H/t2-,3-;/m1./s1 |
| InChIKey | SOHXDJVKUXKZIJ-SWLXLVAMSA-N |
| XLogP | 1.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride?
The IUPAC name of trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride (CID 71656092) is trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride.
What is the SMILES notation for trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride?
The canonical SMILES for trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride is Cl.N[C@@H]1C[C@H]1C(F)(F)F.
What is the InChIKey of trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride?
The InChIKey is SOHXDJVKUXKZIJ-SWLXLVAMSA-N. The full InChI is InChI=1S/C4H6F3N.ClH/c5-4(6,7)2-1-3(2)8;/h2-3H,1,8H2;1H/t2-,3-;/m1./s1.
What are the key properties of trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride?
trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride has a molecular weight of 161.55 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 71656092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).