C25H23F6NO7 — CID 71656311
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)-methoxymethyl]piperidine-1-carboxylate (PubChem CID 71656311) has the molecular formula C25H23F6NO7 and a molecular weight of 563.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)-methoxymethyl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)-methoxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71656311 |
| Molecular Formula | C25H23F6NO7 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)-methoxymethyl]piperidine-1-carboxylate |
| SMILES | COC(c1ccc2c(c1)OCO2)(c1ccc2c(c1)OCO2)C1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H23F6NO7/c1-34-23(15-2-4-17-19(10-15)37-12-35-17,16-3-5-18-20(11-16)38-13-36-18)14-6-8-32(9-7-14)22(33)39-21(24(26,27)28)25(29,30)31/h2-5,10-11,14,21H,6-9,12-13H2,1H3 |
| InChIKey | GDWCAHSCKGGICR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |