C24H19F6NO6 — CID 71656313
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methylidene]piperidine-1-carboxylate (PubChem CID 71656313) has the molecular formula C24H19F6NO6 and a molecular weight of 531.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methylidene]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71656313 |
| Molecular Formula | C24H19F6NO6 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methylidene]piperidine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(=C(c2ccc3c(c2)OCO3)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H19F6NO6/c25-23(26,27)21(24(28,29)30)37-22(32)31-7-5-13(6-8-31)20(14-1-3-16-18(9-14)35-11-33-16)15-2-4-17-19(10-15)36-12-34-17/h1-4,9-10,21H,5-8,11-12H2 |
| InChIKey | MZKFJOCKACTXKR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |