C23H20F6N2O6 — CID 71656416
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxylate (PubChem CID 71656416) has the molecular formula C23H20F6N2O6 and a molecular weight of 534.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71656416 |
| Molecular Formula | C23H20F6N2O6 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[bis(1,3-benzodioxol-5-yl)methyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(C(c2ccc3c(c2)OCO3)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H20F6N2O6/c24-22(25,26)20(23(27,28)29)37-21(32)31-7-5-30(6-8-31)19(13-1-3-15-17(9-13)35-11-33-15)14-2-4-16-18(10-14)36-12-34-16/h1-4,9-10,19-20H,5-8,11-12H2 |
| InChIKey | JHQPFZLAYNFZTC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |