About (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine
(2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine (PubChem CID 71656420) has the molecular formula C17H15F2N3O
and a molecular weight of 315.32 g/mol. Its IUPAC name is (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine.
Molecular Properties
| Compound Name | (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine |
| PubChem CID | 71656420 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine |
| SMILES | Fc1cc(F)c2nc(-c3ccc([C@H]4CNCCO4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C17H15F2N3O/c18-12-7-13(19)16-14(8-12)21-17(22-16)11-3-1-10(2-4-11)15-9-20-5-6-23-15/h1-4,7-8,15,20H,5-6,9H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | UJQNAOGCMDNXED-OAHLLOKOSA-N |
| XLogP | 3.17 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine?
The IUPAC name of (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine (CID 71656420) is (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine.
What is the SMILES notation for (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine?
The canonical SMILES for (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine is Fc1cc(F)c2nc(-c3ccc([C@H]4CNCCO4)cc3)[nH]c2c1.
What is the InChIKey of (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine?
The InChIKey is UJQNAOGCMDNXED-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H15F2N3O/c18-12-7-13(19)16-14(8-12)21-17(22-16)11-3-1-10(2-4-11)15-9-20-5-6-23-15/h1-4,7-8,15,20H,5-6,9H2,(H,21,22)/t15-/m1/s1.
What are the key properties of (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine?
(2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine has a molecular weight of 315.32 g/mol, XLogP of 3.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-(4,6-difluoro-1H-benzimidazol-2-yl)phenyl]morpholine is sourced from PubChem (CID 71656420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).