About (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine
(2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine (PubChem CID 71656422) has the molecular formula C19H21N3O
and a molecular weight of 307.40 g/mol. Its IUPAC name is (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine.
Molecular Properties
| Compound Name | (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine |
| PubChem CID | 71656422 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine |
| SMILES | Cc1cc2nc(-c3ccc([C@H]4CNCCO4)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C19H21N3O/c1-12-9-16-17(10-13(12)2)22-19(21-16)15-5-3-14(4-6-15)18-11-20-7-8-23-18/h3-6,9-10,18,20H,7-8,11H2,1-2H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | XTUFXTCPHNTHIW-GOSISDBHSA-N |
| XLogP | 3.51 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine?
The IUPAC name of (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine (CID 71656422) is (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine.
What is the SMILES notation for (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine?
The canonical SMILES for (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine is Cc1cc2nc(-c3ccc([C@H]4CNCCO4)cc3)[nH]c2cc1C.
What is the InChIKey of (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine?
The InChIKey is XTUFXTCPHNTHIW-GOSISDBHSA-N. The full InChI is InChI=1S/C19H21N3O/c1-12-9-16-17(10-13(12)2)22-19(21-16)15-5-3-14(4-6-15)18-11-20-7-8-23-18/h3-6,9-10,18,20H,7-8,11H2,1-2H3,(H,21,22)/t18-/m1/s1.
What are the key properties of (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine?
(2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine has a molecular weight of 307.40 g/mol, XLogP of 3.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]morpholine is sourced from PubChem (CID 71656422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).