C15H13F6N3O3 — CID 71656625
1,1,1,3,3,3-hexafluoropropan-2-yl N-methyl-N-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamate (PubChem CID 71656625) has the molecular formula C15H13F6N3O3 and a molecular weight of 397.28 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl N-methyl-N-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl N-methyl-N-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 71656625 |
| Molecular Formula | C15H13F6N3O3 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl N-methyl-N-[[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamate |
| SMILES | Cc1nc(-c2cccc(CN(C)C(=O)OC(C(F)(F)F)C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C15H13F6N3O3/c1-8-22-11(23-27-8)10-5-3-4-9(6-10)7-24(2)13(25)26-12(14(16,17)18)15(19,20)21/h3-6,12H,7H2,1-2H3 |
| InChIKey | KURBQAQJRCDUTM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |