C25H30FN5OS — CID 71656750
1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[2-cyclohexyl-4-(4-fluoro-3-methylphenyl)imidazol-1-yl]ethanone (PubChem CID 71656750) has the molecular formula C25H30FN5OS and a molecular weight of 467.61 g/mol. Its IUPAC name is 1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[2-cyclohexyl-4-(4-fluoro-3-methylphenyl)imidazol-1-yl]ethanone.
| Compound Name | 1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[2-cyclohexyl-4-(4-fluoro-3-methylphenyl)imidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 71656750 |
| Molecular Formula | C25H30FN5OS |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[2-cyclohexyl-4-(4-fluoro-3-methylphenyl)imidazol-1-yl]ethanone |
| SMILES | Cc1cc(-c2cn(CC(=O)N3CCc4nc(N)sc4CC3)c(C3CCCCC3)n2)ccc1F |
| InChI | InChI=1S/C25H30FN5OS/c1-16-13-18(7-8-19(16)26)21-14-31(24(28-21)17-5-3-2-4-6-17)15-23(32)30-11-9-20-22(10-12-30)33-25(27)29-20/h7-8,13-14,17H,2-6,9-12,15H2,1H3,(H2,27,29) |
| InChIKey | UNYMHUUCIULLGF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |