C25H23F2N5OS — CID 71656754
1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]ethanone (PubChem CID 71656754) has the molecular formula C25H23F2N5OS and a molecular weight of 479.56 g/mol. Its IUPAC name is 1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]ethanone.
| Compound Name | 1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 71656754 |
| Molecular Formula | C25H23F2N5OS |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1-(2-amino-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl)-2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]ethanone |
| SMILES | Cc1cc(-c2cn(CC(=O)N3CCc4nc(N)sc4CC3)c(-c3ccc(F)cc3)n2)ccc1F |
| InChI | InChI=1S/C25H23F2N5OS/c1-15-12-17(4-7-19(15)27)21-13-32(24(29-21)16-2-5-18(26)6-3-16)14-23(33)31-10-8-20-22(9-11-31)34-25(28)30-20/h2-7,12-13H,8-11,14H2,1H3,(H2,28,30) |
| InChIKey | FTZGIEVXQUQMME-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |