About 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid
4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid (PubChem CID 71657262) has the molecular formula C18H23N5O8
and a molecular weight of 437.41 g/mol. Its IUPAC name is 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid |
| PubChem CID | 71657262 |
| Molecular Formula | C18H23N5O8 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid |
| SMILES | Cc1cn(CCN(CCn2cc(C)c(=O)[nH]c2=O)C(=O)CC(O)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H23N5O8/c1-10-8-22(17(30)19-14(10)26)5-3-21(13(25)7-12(24)16(28)29)4-6-23-9-11(2)15(27)20-18(23)31/h8-9,12,24H,3-7H2,1-2H3,(H,28,29)(H,19,26,30)(H,20,27,31) |
| InChIKey | OQGPHOXHZBIXSC-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 187.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid?
The IUPAC name of 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid (CID 71657262) is 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid.
What is the SMILES notation for 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid?
The canonical SMILES for 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid is Cc1cn(CCN(CCn2cc(C)c(=O)[nH]c2=O)C(=O)CC(O)C(=O)O)c(=O)[nH]c1=O.
What is the InChIKey of 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid?
The InChIKey is OQGPHOXHZBIXSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O8/c1-10-8-22(17(30)19-14(10)26)5-3-21(13(25)7-12(24)16(28)29)4-6-23-9-11(2)15(27)20-18(23)31/h8-9,12,24H,3-7H2,1-2H3,(H,28,29)(H,19,26,30)(H,20,27,31).
What are the key properties of 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid?
4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid has a molecular weight of 437.41 g/mol, XLogP of -2.63, 9 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]amino]-2-hydroxy-4-oxobutanoic acid is sourced from PubChem (CID 71657262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).