C20H24FN5OS — CID 71657445
4-(6-fluoro-2,3-dihydroindol-1-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-1-carboxamide (PubChem CID 71657445) has the molecular formula C20H24FN5OS and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-(6-fluoro-2,3-dihydroindol-1-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-1-carboxamide.
| Compound Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71657445 |
| Molecular Formula | C20H24FN5OS |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CNCC2)N1CCC(N2CCc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C20H24FN5OS/c21-14-2-1-13-4-10-26(17(13)11-14)15-5-8-25(9-6-15)20(27)24-19-23-16-3-7-22-12-18(16)28-19/h1-2,11,15,22H,3-10,12H2,(H,23,24,27) |
| InChIKey | PXOQMUPPNGWVGC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |